2H-Pyrazolo[3,4-b]pyridine
1H-pyrazolo[3,4-b]pyridine
CAS: 271-71-6;271-73-8
Molecular Formula: C6H5N3
2H-Pyrazolo[3,4-b]pyridine - Names and Identifiers
| Name | 1H-pyrazolo[3,4-b]pyridine |
| Synonyms | 7-Aza-2H-indazole pyrazolo[3,4-b]pyridine pyrazolo(3,4-b)pyridine 2H-Pyrazolo[3,4-b]pyridine 1H-pyrazolo(3,4-b)pyridine 1H-pyrazolo[3,4-b]pyridine 2H-pyrazolo[3,4-b]pyridine |
| CAS | 271-71-6 271-73-8 |
| InChI | InChI=1/C6H5N3/c1-2-5-4-8-9-6(5)7-3-1/h1-4H,(H,7,8,9) |
2H-Pyrazolo[3,4-b]pyridine - Physico-chemical Properties
| Molecular Formula | C6H5N3 |
| Molar Mass | 119.12 |
| Density | 1.348 |
| Melting Point | 99-101℃ |
| Boling Point | 294.466°C at 760 mmHg |
| Flash Point | 145.716°C |
| Vapor Presure | 0.003mmHg at 25°C |
| pKa | 10.87±0.30(Predicted) |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.715 |
2H-Pyrazolo[3,4-b]pyridine - Introduction
1H-pyrazolo[3,4-b]pyridine is a heterocyclic organic compound with the chemical formula C8H6N2. It has the following properties:
1. Appearance: 1H-pyrazolo[3,4-b]pyridine is a white to light yellow crystalline or powdery solid.
2. Solubility: It is relatively soluble in common organic solvents such as ethanol, ether and dimethyl sulfoxide.
3. Melting point and boiling point: 1H-pyrazolo[3,4-b]pyridine has a melting point of about 176-180 ℃ and a boiling point of about 333-337 ℃.
The main uses of 1H-pyrazolo[3,4-b]pyridine are as follows:
1. Chemical synthesis intermediate: It can be used as an important intermediate in organic synthesis and is used to prepare various heterocyclic compounds.
2. Drugs: 1H-pyrazolo[3,4-b]pyridine and its derivatives have a variety of biological activities, so researchers widely use them in drug discovery and development.
There are various methods for preparing 1H-pyrazolo[3,4-b]pyridine. One commonly used method is synthesis by selective oxidation and reduction reactions. The specific steps are as follows:
1. Pyridine and carbonyl compounds (such as aldehydes, ketones) reaction, reaction products.
2. The selective oxidation reaction of the reaction product can use various oxidants such as oxygen, hydrogen peroxide, etc.
3. After oxidation reaction, the product of 1H-pyrazolo[3,4-b]pyridine was obtained.
When using 1H-pyrazolo[3,4-b]pyridine safely, the following should be noted:
1. It may cause irritation and damage to the skin, eyes and respiratory tract, so personal protective equipment should be worn during operation.
2. Avoid inhaling the dust or vapor of 1H-pyrazolo[3,4-b]pyridine, and ensure that the operating place is well ventilated.
3. When storing and handling, it should be kept in a sealed, dry and cool place.
4. Try to avoid prolonged exposure to the substance, avoid ingestion and skin absorption.
1. Appearance: 1H-pyrazolo[3,4-b]pyridine is a white to light yellow crystalline or powdery solid.
2. Solubility: It is relatively soluble in common organic solvents such as ethanol, ether and dimethyl sulfoxide.
3. Melting point and boiling point: 1H-pyrazolo[3,4-b]pyridine has a melting point of about 176-180 ℃ and a boiling point of about 333-337 ℃.
The main uses of 1H-pyrazolo[3,4-b]pyridine are as follows:
1. Chemical synthesis intermediate: It can be used as an important intermediate in organic synthesis and is used to prepare various heterocyclic compounds.
2. Drugs: 1H-pyrazolo[3,4-b]pyridine and its derivatives have a variety of biological activities, so researchers widely use them in drug discovery and development.
There are various methods for preparing 1H-pyrazolo[3,4-b]pyridine. One commonly used method is synthesis by selective oxidation and reduction reactions. The specific steps are as follows:
1. Pyridine and carbonyl compounds (such as aldehydes, ketones) reaction, reaction products.
2. The selective oxidation reaction of the reaction product can use various oxidants such as oxygen, hydrogen peroxide, etc.
3. After oxidation reaction, the product of 1H-pyrazolo[3,4-b]pyridine was obtained.
When using 1H-pyrazolo[3,4-b]pyridine safely, the following should be noted:
1. It may cause irritation and damage to the skin, eyes and respiratory tract, so personal protective equipment should be worn during operation.
2. Avoid inhaling the dust or vapor of 1H-pyrazolo[3,4-b]pyridine, and ensure that the operating place is well ventilated.
3. When storing and handling, it should be kept in a sealed, dry and cool place.
4. Try to avoid prolonged exposure to the substance, avoid ingestion and skin absorption.
Last Update：2024-04-09 20:49:11
![2H-Pyrazolo[3,4-b]pyridine](http://res.chembk.com/assets/images/structure/271-71-6.gif)
Supplier List
Multiple Specifications
Product Name: 1H-pyrazolo[3,4-b]pyridine Visit Supplier Webpage Request for quotationCAS: 271-71-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 1H-PYRAZOLO[3,4-B]PYRIDINE Request for quotation
CAS: 271-73-8
Tel: 0086-13605431940
Email: xuli678323@126.com
Mobile: +86-13605431940
QQ: 56860987
Wechat: 13605431940
WhatsApp: 13605431940
CAS: 271-73-8
Tel: 0086-13605431940
Email: xuli678323@126.com
Mobile: +86-13605431940
QQ: 56860987
Wechat: 13605431940
WhatsApp: 13605431940
Multiple Specifications
Product Name: 1H-pyrazolo[3,4-b]pyridine Visit Supplier Webpage Request for quotationCAS: 271-71-6
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: 1H-PYRAZOLO[3,4-B]PYRIDINE Request for quotation
CAS: 271-73-8
Tel: 0086-13605431940
Email: xuli678323@126.com
Mobile: +86-13605431940
QQ: 56860987
Wechat: 13605431940
WhatsApp: 13605431940
CAS: 271-73-8
Tel: 0086-13605431940
Email: xuli678323@126.com
Mobile: +86-13605431940
QQ: 56860987
Wechat: 13605431940
WhatsApp: 13605431940
View History